|
CAS#: 20045-34-5 Product: Pyrogallol, Potassium Salt No suppilers available for the product. |
| Name | Pyrogallol, Potassium Salt |
|---|---|
| Synonyms | 1,2,3-Benzenetriol, Potassium Salt; Potassium Pyrogallate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5KO3 |
| Molecular Weight | 164.20 |
| CAS Registry Number | 20045-34-5 |
| EINECS | 243-483-5 |
| SMILES | C1=C([O-])C(=C(O)C=C1)O.[K+] |
| InChI | 1S/C6H6O3.K/c7-4-2-1-3-5(8)6(4)9;/h1-3,7-9H;/q;+1/p-1 |
| InChIKey | DZHJVFXTMQJEKR-UHFFFAOYSA-M |
| Boiling point | 309°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyrogallol, Potassium Salt |