Online Database of Chemicals from Around the World
|
CAS#: 20116-65-8 Product: Dimethyl 4-Methylphthalate No suppilers available for the product. |
| Name | Dimethyl 4-Methylphthalate |
|---|---|
| Synonyms | 4-Methylbenzene-1,2-Dicarboxylic Acid Dimethyl Ester; 1,2-Benzenedicarboxylic Acid, 4-Methyl-, Dimethyl Ester; Dimethyl 4-Methylphthalate |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 20116-65-8 |
| EINECS | 243-522-6 |
| SMILES | C1=C(C=C(C(=C1)C(=O)OC)C(=O)OC)C |
| InChI | 1S/C11H12O4/c1-7-4-5-8(10(12)14-2)9(6-7)11(13)15-3/h4-6H,1-3H3 |
| InChIKey | GICLKLDOSTVQQA-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.464°C at 760 mmHg (Cal.) |
| Flash point | 127.576°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-Methylphthalate |