|
CAS#: 20165-38-2 Product: 1,1,2-Trifluorotrinitroethane No suppilers available for the product. |
| Name | 1,1,2-Trifluorotrinitroethane |
|---|---|
| Synonyms | 1,1,2-Trifluoro-1,2,2-Trinitro-Ethane; 1,1,2-Trifluorotrinitroethane |
| Molecular Structure | ![]() |
| Molecular Formula | C2F3N3O6 |
| Molecular Weight | 219.03 |
| CAS Registry Number | 20165-38-2 |
| SMILES | O=[N+]([O-])C(F)([N+]([O-])=O)C(F)(F)[N+]([O-])=O |
| InChI | 1S/C2F3N3O6/c3-1(4,6(9)10)2(5,7(11)12)8(13)14 |
| InChIKey | YZXMNZPACCLUCJ-UHFFFAOYSA-N |
| Density | 1.883g/cm3 (Cal.) |
|---|---|
| Boiling point | 83.492°C at 760 mmHg (Cal.) |
| Flash point | 4.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2-Trifluorotrinitroethane |