|
CAS#: 2023-61-2 Product: 11-Fluoro-7,12-Dimethylbenzo[b]Phenanthrene No suppilers available for the product. |
| Name | 11-Fluoro-7,12-Dimethylbenzo[b]Phenanthrene |
|---|---|
| Synonyms | 11-Fluoro-7,12-Dimethyl-Benzo[B]Phenanthrene; 11-Fluoro-7,12-Dimethylbenz[A]Anthracene; 7,12-Dimethyl-11-Fluorobenz[A]Anthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15F |
| Molecular Weight | 274.34 |
| CAS Registry Number | 2023-61-2 |
| SMILES | C2=C1C(=C4C(=C(C1=C(C=C2)F)C)C3=CC=CC=C3C=C4)C |
| InChI | 1S/C20H15F/c1-12-15-8-5-9-18(21)20(15)13(2)19-16(12)11-10-14-6-3-4-7-17(14)19/h3-11H,1-2H3 |
| InChIKey | FKCRHSIFNGMCEP-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.357°C at 760 mmHg (Cal.) |
| Flash point | 213.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Fluoro-7,12-Dimethylbenzo[b]Phenanthrene |