|
CAS#: 20241-75-2 Product: 1,5-Dihydroxy-4,8-Bis[(4-Methylphenyl)Amino]Anthraquinone No suppilers available for the product. |
| Name | 1,5-Dihydroxy-4,8-Bis[(4-Methylphenyl)Amino]Anthraquinone |
|---|---|
| Synonyms | 1,5-Dihydroxy-4,8-Bis[(4-Methylphenyl)Amino]-9,10-Anthraquinone; Nsc508898; 9,10-Anthracenedione, 1,5-Dihydroxy-4,8-Bis[(4-Methylphenyl)Amino]- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 |
| CAS Registry Number | 20241-75-2 |
| EINECS | 243-631-9 |
| SMILES | C1=CC(=CC=C1C)NC5=C4C(=O)C2=C(C(=CC=C2O)NC3=CC=C(C=C3)C)C(C4=C(C=C5)O)=O |
| InChI | 1S/C28H22N2O4/c1-15-3-7-17(8-4-15)29-19-11-13-21(31)25-23(19)27(33)26-22(32)14-12-20(24(26)28(25)34)30-18-9-5-16(2)6-10-18/h3-14,29-32H,1-2H3 |
| InChIKey | USXUIUWGIGFKRR-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 640.971°C at 760 mmHg (Cal.) |
| Flash point | 341.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dihydroxy-4,8-Bis[(4-Methylphenyl)Amino]Anthraquinone |