| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 3,3-Dimethyl-1-(3-Nitrophenyl)-Triazene |
|---|---|
| Synonyms | N-Methyl-N-(3-Nitrophenyl)Azo-Methanamine; N-Methyl-N-(3-Nitrophenyl)Azomethanamine; Dimethyl-(3-Nitrophenyl)Azo-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 20241-06-9 |
| SMILES | C1=C(C=CC=C1N=NN(C)C)[N+](=O)[O-] |
| InChI | 1S/C8H10N4O2/c1-11(2)10-9-7-4-3-5-8(6-7)12(13)14/h3-6H,1-2H3 |
| InChIKey | JKJVFVAYXDTCRD-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.473°C at 760 mmHg (Cal.) |
| Flash point | 128.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-1-(3-Nitrophenyl)-Triazene |