| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 1,1-Diphenylguanidine |
|---|---|
| Synonyms | Guanidine, N,N-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 20277-92-3 |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=N)N |
| InChI | 1S/C13H13N3/c14-13(15)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H3,14,15) |
| InChIKey | MFHNAXHSHOCFEC-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Melting point | 150°C (Expl.) |
| Boiling point | 170°C (Expl.) |
| 338.461°C at 760 mmHg (Cal.) | |
| Flash point | 170°C (Expl.) |
| 158.496°C (Cal.) | |
| Safety Description | Safety glasses, gloves, adequate ventilation. |
|---|---|
| (1) | Luke C. Henderson, Jian Li, Roger L. Nation, Tony Velkov and Frederick M. Pfeffer. Developing an anion host for lipid A binding and antibacterial activity, Chem. Commun., 2010, 46, 3197. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1-Diphenylguanidine |