|
CAS#: 20282-28-4 Product: 2-Propyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 2-Propyl-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-Phenyl-2-Propyl-Benzene; 1,1'-Biphenyl, 2-Propyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 20282-28-4 |
| SMILES | C1=C(C(=CC=C1)C2=CC=CC=C2)CCC |
| InChI | 1S/C15H16/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14/h3-7,9-12H,2,8H2,1H3 |
| InChIKey | ZZRGDSMZKOGYPC-UHFFFAOYSA-N |
| Density | 0.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.364°C at 760 mmHg (Cal.) |
| Flash point | 149.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propyl-1,1'-Biphenyl |