|
CAS#: 20298-70-8 Product: trans-2-Tert-Butylcyclohexyl Acetate No suppilers available for the product. |
| Name | trans-2-Tert-Butylcyclohexyl Acetate |
|---|---|
| Synonyms | Acetic Acid [(1R,2S)-2-Tert-Butylcyclohexyl] Ester; [(1R,2S)-2-Tert-Butylcyclohexyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 20298-70-8 |
| EINECS | 243-719-7 |
| SMILES | [C@H]1(OC(=O)C)[C@H](C(C)(C)C)CCCC1 |
| InChI | 1S/C12H22O2/c1-9(13)14-11-8-6-5-7-10(11)12(2,3)4/h10-11H,5-8H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | FINOAUDUYKVGDS-GHMZBOCLSA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.215°C at 760 mmHg (Cal.) |
| Flash point | 90.841°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for trans-2-Tert-Butylcyclohexyl Acetate |