|
CAS#: 2032-13-5 Product: 5,5-Di(Phenyl)Imidazolidine-2,4-Dithione No suppilers available for the product. |
| Name | 5,5-Di(Phenyl)Imidazolidine-2,4-Dithione |
|---|---|
| Synonyms | Oprea1_827654; 5,5-Diphenyl-2,4-Dithiohydantoin; 5-24-08-00411 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2S2 |
| Molecular Weight | 284.39 |
| CAS Registry Number | 2032-13-5 |
| SMILES | C1=CC=CC=C1C2(NC(=S)NC2=S)C3=CC=CC=C3 |
| InChI | 1S/C15H12N2S2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | IPDQDGCZABYZKF-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.57°C at 760 mmHg (Cal.) |
| Flash point | 200.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Di(Phenyl)Imidazolidine-2,4-Dithione |