|
CAS#: 20329-82-2 Product: (3,4-Dimethoxyphenyl)-Hydrazine Hydrochloride No suppilers available for the product. |
| Name | (3,4-Dimethoxyphenyl)-Hydrazine Hydrochloride |
|---|---|
| Synonyms | Hydrazine, (3,4-Dimethoxyphenyl)-, Hydrochloride; (3,4-Dimethoxyphenyl)Hydrazine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 |
| CAS Registry Number | 20329-82-2 |
| EINECS | 254-795-6 |
| SMILES | [H+].C1=C(NN)C=CC(=C1OC)OC.[Cl-] |
| InChI | 1S/C8H12N2O2.ClH/c1-11-7-4-3-6(10-9)5-8(7)12-2;/h3-5,10H,9H2,1-2H3;1H |
| InChIKey | HRSRMSMAVYUKRC-UHFFFAOYSA-N |
| Boiling point | 290.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,4-Dimethoxyphenyl)-Hydrazine Hydrochloride |