|
CAS#: 20342-64-7 Product: Indole-4,7-Dione No suppilers available for the product. |
| Name | Indole-4,7-Dione |
|---|---|
| Synonyms | 1H-Indole-4,7-Quinone; Indole-4,7-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 |
| CAS Registry Number | 20342-64-7 |
| SMILES | C1=CC2=C([NH]1)C(C=CC2=O)=O |
| InChI | 1S/C8H5NO2/c10-6-1-2-7(11)8-5(6)3-4-9-8/h1-4,9H |
| InChIKey | QMRIWYCCTCNABA-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.324°C at 760 mmHg (Cal.) |
| Flash point | 180.712°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indole-4,7-Dione |