Online Database of Chemicals from Around the World
|
CAS#: 20480-67-5 Product: trans-1,2,3,4,4a,9,10,10alpha-Octahydrophenanthrene No suppilers available for the product. |
| Name | trans-1,2,3,4,4a,9,10,10alpha-Octahydrophenanthrene |
|---|---|
| Synonyms | Ccris 7437; Trans-1,2,3,4,4A,9,10,10A-Octahydrophenanthrene |
| Molecular Structure |  |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 |
| CAS Registry Number | 20480-67-5 |
| SMILES | [C@@H]12CCCC[C@H]1CCC3=C2C=CC=C3 |
| InChI | 1S/C14H18/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1,3,5,7,12,14H,2,4,6,8-10H2/t12-,14+/m0/s1 |
| InChIKey | KFGROPZLGDSAPK-GXTWGEPZSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.846°C at 760 mmHg (Cal.) |
| Flash point | 123.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-1,2,3,4,4a,9,10,10alpha-Octahydrophenanthrene |