| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 2-Chloro-N-Cyclopentyl-2'-C-Methyladenosine |
|---|---|
| Synonyms | (2R,3R,4R |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.83 |
| CAS Registry Number | 205171-12-6 |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)Cl)NC4CCCC4)CO)O)O |
| InChI | 1S/C16H22ClN5O4/c1-16(25)11(24)9(6-23)26-14(16)22-7-18-10-12(19-8-4-2-3-5-8)20-15(17)21-13(10)22/h7-9,11,14,23-25H,2-6H2,1H3,(H,19,20,21)/t9-,11-,14-,16-/m1/s1 |
| InChIKey | MMPAUXMIDJWGFO-ROMFRFKVSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 643.3±65.0°C at 760 mmHg (Cal.) |
| Flash point | 342.9±34.3°C (Cal.) |
| Refractive index | 1.777 (Cal.) |
| solubility | Soluble to 25 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-Cyclopentyl-2'-C-Methyladenosine |