|
CAS#: 20524-59-8 Product: 1,2,3,4,5,7,7-Heptachlorobicyclo[2.2.1]Hepta-2,5-Diene No suppilers available for the product. |
| Name | 1,2,3,4,5,7,7-Heptachlorobicyclo[2.2.1]Hepta-2,5-Diene |
|---|---|
| Synonyms | Bicyclo(2.2.1)Hepta-2,5-Diene, 1,2,3,4,5,7,7-Heptachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7HCl7 |
| Molecular Weight | 333.26 |
| CAS Registry Number | 20524-59-8 |
| SMILES | ClC1=C(C2(C=C(C1(Cl)C2(Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C7HCl7/c8-2-1-5(11)3(9)4(10)6(2,12)7(5,13)14/h1H |
| InChIKey | NSLUNJDAHOVMDS-UHFFFAOYSA-N |
| Density | 1.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.393°C at 760 mmHg (Cal.) |
| Flash point | 147.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,7,7-Heptachlorobicyclo[2.2.1]Hepta-2,5-Diene |