|
CAS#: 20557-73-7 Product: 3,5-Dimethyl-4-dimethylaminoazobenzene No suppilers available for the product. |
| Name | 3,5-Dimethyl-4-dimethylaminoazobenzene |
|---|---|
| Synonyms | N,N,2,6-Tetramethyl-4-Phenylazo-Aniline; N,N,2,6-Tetramethyl-4-Phenylazoaniline; (2,6-Dimethyl-4-Phenylazo-Phenyl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 |
| CAS Registry Number | 20557-73-7 |
| SMILES | C1=C(C(=C(C=C1N=NC2=CC=CC=C2)C)N(C)C)C |
| InChI | 1S/C16H19N3/c1-12-10-15(11-13(2)16(12)19(3)4)18-17-14-8-6-5-7-9-14/h5-11H,1-4H3 |
| InChIKey | FKXMWTSMGOCHQB-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.449°C at 760 mmHg (Cal.) |
| Flash point | 197.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethyl-4-dimethylaminoazobenzene |