|
CAS#: 20627-34-3 Product: 6,8,12-Trimethyl-Benz(a)Anthracene No suppilers available for the product. |
| Name | 6,8,12-Trimethyl-Benz(a)Anthracene |
|---|---|
| Synonyms | 6,8,12-Trimethylbenz(A)Anthracene; Brn 1970612; Benz(A)Anthracene, 6,8,12-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 20627-34-3 |
| SMILES | C1=C3C(=C(C2=CC=CC(=C12)C)C)C4=C(C=C3C)C=CC=C4 |
| InChI | 1S/C21H18/c1-13-7-6-10-17-15(3)21-18-9-5-4-8-16(18)11-14(2)20(21)12-19(13)17/h4-12H,1-3H3 |
| InChIKey | ZUXQCNITNWNRAE-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.502°C at 760 mmHg (Cal.) |
| Flash point | 236.754°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8,12-Trimethyl-Benz(a)Anthracene |