|
CAS#: 20627-73-0 Product: Ortho-Nitrobenzaldehydedimethylacetal No suppilers available for the product. |
| Name | Ortho-Nitrobenzaldehydedimethylacetal |
|---|---|
| Synonyms | 1-(Dimethoxymethyl)-2-Nitro-Benzene; Benzene, 1-(Dimethoxymethyl)-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 20627-73-0 |
| SMILES | C1=C(C(=CC=C1)[N+]([O-])=O)C(OC)OC |
| InChI | 1S/C9H11NO4/c1-13-9(14-2)7-5-3-4-6-8(7)10(11)12/h3-6,9H,1-2H3 |
| InChIKey | OAPZTGKQZKPVPF-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 275°C at 760 mmHg (Cal.) |
| Flash point | 117.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ortho-Nitrobenzaldehydedimethylacetal |