|
CAS#: 20668-33-1 Product: 6,7-Dimethylquinoline No suppilers available for the product. |
| Name | 6,7-Dimethylquinoline |
|---|---|
| Synonyms | 6,7-Dmq; Quinoline, 6,7-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.21 |
| CAS Registry Number | 20668-33-1 |
| SMILES | C1=C2C(=CC(=C1C)C)N=CC=C2 |
| InChI | 1S/C11H11N/c1-8-6-10-4-3-5-12-11(10)7-9(8)2/h3-7H,1-2H3 |
| InChIKey | UJSRVVQKNSYGKS-UHFFFAOYSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.359°C at 760 mmHg (Cal.) |
| Flash point | 116.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethylquinoline |