|
CAS#: 20694-23-9 Product: Ytterbium Dtpa No suppilers available for the product. |
| Name | Ytterbium Dtpa |
|---|---|
| Synonyms | 2-[Bis[2-[Bis(2-Oxido-2-Oxo-Ethyl)Amino]Ethyl]Amino]Acetate; Ytterbium(+3) Cation; 2-[Bis[2-[Bis(2-Keto-2-Oxido-Ethyl)Amino]Ethyl]Amino]Acetate; Ytterbium(+3) Cation; 2-[Bis[2-[Bis(2-Oxido-2-Oxo-Ethyl)Amino]Ethyl]Amino]Ethanoate; Ytterbium(+3) Cation |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N3O10Yb |
| Molecular Weight | 561.36 |
| CAS Registry Number | 20694-23-9 |
| SMILES | [Yb+3].C(N(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O)CN(CC([O-])=O)CC([O-])=O |
| InChI | 1S/C14H23N3O10.Yb/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);/q;+3/p-5 |
| InChIKey | NPTWZTXWSPAEMI-UHFFFAOYSA-I |
| Boiling point | 721.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 389.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ytterbium Dtpa |