|
CAS#: 20770-23-4 Product: 1-(4-Bromophenyl)-9,10-Anthraquinone No suppilers available for the product. |
| Name | 1-(4-Bromophenyl)-9,10-Anthraquinone |
|---|---|
| Synonyms | 1-(4-Bromophenyl)anthra-9,10-quinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H11BrO2 |
| Molecular Weight | 363.20 |
| CAS Registry Number | 20770-23-4 |
| SMILES | Brc4ccc(c3cccc2C(=O)c1ccccc1C(=O)c23)cc4 |
| InChI | 1S/C20H11BrO2/c21-13-10-8-12(9-11-13)14-6-3-7-17-18(14)20(23)16-5-2-1-4-15(16)19(17)22/h1-11H |
| InChIKey | BRVNSUWHDIWCGQ-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.658°C at 760 mmHg (Cal.) |
| Flash point | 166.404°C (Cal.) |
| Refractive index | 1.68 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Bromophenyl)-9,10-Anthraquinone |