Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4,4'-Bis[2,2-Bis(4-Bromophenyl)Vinyl]Biphenyl |
|---|---|
| Synonyms | 1,1'-BIPHENYL,4,4'-BIS[2,2-BIS(4-BROMOPHENYL)ETHENYL]-; 4,4'-Bis[2,2-bis(4-bromophenyl)vinyl]-1,1'-biphenyl |
| Molecular Structure | ![CAS#: 209802-63-1, 4,4'-Bis[2,2-Bis(4-Bromophenyl)Vinyl]Biphenyl](/moreStructures/209802-63-1.gif) |
| Molecular Formula | C40H26Br4 |
| Molecular Weight | 826.25 |
| CAS Registry Number | 209802-63-1 |
| SMILES | c1cc(ccc1C=C(c2ccc(cc2)Br)c3ccc(cc3)Br)c4ccc(cc4)C=C(c5ccc(cc5)Br)c6ccc(cc6)Br |
| InChI | 1S/C40H26Br4/c41-35-17-9-31(10-18-35)39(32-11-19-36(42)20-12-32)25-27-1-5-29(6-2-27)30-7-3-28(4-8-30)26-40(33-13-21-37(43)22-14-33)34-15-23-38(44)24-16-34/h1-26H |
| InChIKey | YXMBIIMLUURBDE-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 753.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 390.7±27.6°C (Cal.) |
| Refractive index | 1.709 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Bis[2,2-Bis(4-Bromophenyl)Vinyl]Biphenyl |