|
CAS#: 2103-47-1 Product: N,N-Dimethyl-N'-(3-Nitrophenyl)Methanimidamide No suppilers available for the product. |
| Name | N,N-Dimethyl-N'-(3-Nitrophenyl)Methanimidamide |
|---|---|
| Synonyms | N,N-Dimethyl-N'-(3-Nitrophenyl)Formamidine; Formamidine, N,N-Dimethyl-N'-(M-Nitrophenyl)-; N'-(4-Nitro-Phenyl)-N,N-Dimethyl-Formamidine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 2103-47-1 |
| SMILES | C1=C(N=CN(C)C)C=CC=C1[N+]([O-])=O |
| InChI | 1S/C9H11N3O2/c1-11(2)7-10-8-4-3-5-9(6-8)12(13)14/h3-7H,1-2H3 |
| InChIKey | LQXZCPNRKDUVET-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.884°C at 760 mmHg (Cal.) |
| Flash point | 139.399°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-N'-(3-Nitrophenyl)Methanimidamide |