|
CAS#: 21044-87-1 Product: 5-[(1R)-1-(4-Hydroxyphenyl)-2-Propen-1-Yl]-2,3,4-Trimethoxyphenol No suppilers available for the product. |
| Name | 5-[(1R)-1-(4-Hydroxyphenyl)-2-Propen-1-Yl]-2,3,4-Trimethoxyphenol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 |
| CAS Registry Number | 21044-87-1 |
| SMILES | COc1c(cc(c(c1OC)OC)O)[C@H](C=C)c2ccc(cc2)O |
| InChI | 1S/C18H20O5/c1-5-13(11-6-8-12(19)9-7-11)14-10-15(20)17(22-3)18(23-4)16(14)21-2/h5-10,13,19-20H,1H2,2-4H3/t13-/m1/s1 |
| InChIKey | YMGWJOIJYYZHCV-CYBMUJFWSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.553°C at 760 mmHg (Cal.) |
| Flash point | 258.944°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(1R)-1-(4-Hydroxyphenyl)-2-Propen-1-Yl]-2,3,4-Trimethoxyphenol |