|
CAS#: 21113-36-0 Product: 2-Nitro-3,3',4,4'-Tetramethylbiphenyl No suppilers available for the product. |
| Name | 2-Nitro-3,3',4,4'-Tetramethylbiphenyl |
|---|---|
| Synonyms | 1-(3,4-Dimethylphenyl)-3,4-Dimethyl-2-Nitro-Benzene; Biphenyl, 2-Nitro-3,3',4,4'-Tetramethyl-,; Biphenyl, 2-Nitro-3,3',4,4'-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 |
| CAS Registry Number | 21113-36-0 |
| SMILES | C1=C(C(=C(C(=C1)C)C)[N+]([O-])=O)C2=CC(=C(C=C2)C)C |
| InChI | 1S/C16H17NO2/c1-10-5-7-14(9-12(10)3)15-8-6-11(2)13(4)16(15)17(18)19/h5-9H,1-4H3 |
| InChIKey | VZHFRRCMIRFSME-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.302°C at 760 mmHg (Cal.) |
| Flash point | 161.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-3,3',4,4'-Tetramethylbiphenyl |