|
CAS#: 21147-11-5 Product: 1,1'-[2-(Methylsulfinyl)-1,1-Ethenediyl]Dibenzene No suppilers available for the product. |
| Name | 1,1'-[2-(Methylsulfinyl)-1,1-Ethenediyl]Dibenzene |
|---|---|
| Synonyms | [2-(Methylsulfinyl)-1-phenylvinyl]benzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14OS |
| Molecular Weight | 242.34 |
| CAS Registry Number | 21147-11-5 |
| SMILES | O=S(\C=C(/c1ccccc1)c2ccccc2)C |
| InChI | 1S/C15H14OS/c1-17(16)12-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | PSFYWDKTTTYRIS-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.555°C at 760 mmHg (Cal.) |
| Flash point | 211.773°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[2-(Methylsulfinyl)-1,1-Ethenediyl]Dibenzene |