|
CAS#: 21149-14-4 Product: 5-Methyl-3A,7A-Dihydro-1H-Indene-1,7(4H)-Dione No suppilers available for the product. |
| Name | 5-Methyl-3A,7A-Dihydro-1H-Indene-1,7(4H)-Dione |
|---|---|
| Synonyms | 5-Methyl-3a,7a-dihydro-1H-indene-1,7(4H)-dione # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 21149-14-4 |
| SMILES | O=C1\C=C(/CC2/C=C\C(=O)C12)C |
| InChI | 1S/C10H10O2/c1-6-4-7-2-3-8(11)10(7)9(12)5-6/h2-3,5,7,10H,4H2,1H3 |
| InChIKey | JLWMJZRXRYPCNE-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.839°C at 760 mmHg (Cal.) |
| Flash point | 123.636°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-3A,7A-Dihydro-1H-Indene-1,7(4H)-Dione |