|
CAS#: 2118-02-7 Product: Bis(Pentafluorophenyl)Borinic Acid No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl)Borinic Acid |
|---|---|
| Synonyms | di(pentafluorophenyl)hydroxyborane |
| Molecular Structure | ![]() |
| Molecular Formula | C12HBF10O |
| Molecular Weight | 361.93 |
| CAS Registry Number | 2118-02-7 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)B(O)c2c(F)c(F)c(F)c(F)c2F |
| InChI | 1S/C12HBF10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h24H |
| InChIKey | MQXCDPDLPMAEIE-UHFFFAOYSA-N |
| Density | 1.674g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.284°C at 760 mmHg (Cal.) |
| Flash point | 130.569°C (Cal.) |
| Refractive index | 1.445 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Pentafluorophenyl)Borinic Acid |