|
CAS#: 21282-11-1 Product: Pyroglutamylleucine No suppilers available for the product. |
| Name | Pyroglutamylleucine |
|---|---|
| Synonyms | (2S)-4-Methyl-2-[[Oxo-[(2S)-5-Oxo-2-Pyrrolidinyl]Methyl]Amino]Pentanoic Acid; (2S)-4-Methyl-2-(Pyroglutamoylamino)Valeric Acid; (2S)-4-Methyl-2-[[(2S)-5-Oxopyrrolidin-2-Yl]Carbonylamino]Pentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 21282-11-1 |
| SMILES | [C@H](C(=O)O)(NC([C@H]1NC(CC1)=O)=O)CC(C)C |
| InChI | 1S/C11H18N2O4/c1-6(2)5-8(11(16)17)13-10(15)7-3-4-9(14)12-7/h6-8H,3-5H2,1-2H3,(H,12,14)(H,13,15)(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | XXSAFGVAPGOYNT-YUMQZZPRSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.722°C at 760 mmHg (Cal.) |
| Flash point | 303.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyroglutamylleucine |