Online Database of Chemicals from Around the World
|
CAS#: 21288-61-9 Product: epsilon-Pyrromycinone No suppilers available for the product. |
| Name | epsilon-Pyrromycinone |
|---|---|
| Synonyms | 2-Ethyl-2,4,5,7,10-Pentahydroxy-6,11-Dioxo-3,4-Dihydro-1H-Tetracene-1-Carboxylic Acid Methyl Ester; 2-Ethyl-2,4,5,7,10-Pentahydroxy-6,11-Diketo-3,4-Dihydro-1H-Tetracene-1-Carboxylic Acid Methyl Ester; 1-Naphthacenecarboxylic Acid, 2-Ethyl-1,2,3,4,6,11-Hexahydro-2,4,5,7,10-Pentahydroxy-6,11-Dioxo-, Methyl Ester, [1R-(1.Alpha.,2.Beta.,4.Beta.)]- |
| Molecular Structure |  |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.39 |
| CAS Registry Number | 21288-61-9 |
| SMILES | C1=C4C(=C(O)C3=C1C(=O)C2=C(O)C=CC(=C2C3=O)O)C(O)CC(O)(C4C(OC)=O)CC |
| InChI | 1S/C22H20O9/c1-3-22(30)7-12(25)13-8(17(22)21(29)31-2)6-9-14(19(13)27)20(28)16-11(24)5-4-10(23)15(16)18(9)26/h4-6,12,17,23-25,27,30H,3,7H2,1-2H3 |
| InChIKey | RWCVSDKDFSVZNF-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 701.24°C at 760 mmHg (Cal.) |
| Flash point | 247.948°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for epsilon-Pyrromycinone |