|
CAS#: 21373-43-3 Product: 9-Hydroxymethyl-beta-Carboline No suppilers available for the product. |
| Name | 9-Hydroxymethyl-beta-Carboline |
|---|---|
| Synonyms | 9-Pyrido[3,4-B]Indolylmethanol; $B-Carbolin-9-Ylmethanol; 9-Hmbc |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 |
| CAS Registry Number | 21373-43-3 |
| SMILES | C1=CC=CC2=C1[N](CO)C3=C2C=CN=C3 |
| InChI | 1S/C12H10N2O/c15-8-14-11-4-2-1-3-9(11)10-5-6-13-7-12(10)14/h1-7,15H,8H2 |
| InChIKey | TYBDOHPQDOTAGR-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.238°C at 760 mmHg (Cal.) |
| Flash point | 210.977°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Hydroxymethyl-beta-Carboline |