|
CAS#: 21420-58-6 Product: 3-[2-(Methylamino)ethyl]-1H-Indol-4-ol 4-(dihydrogen phosphate) No suppilers available for the product. |
| Name | 3-[2-(Methylamino)ethyl]-1H-Indol-4-ol 4-(dihydrogen phosphate) |
|---|---|
| Synonyms | Baeocystin; 1H-Indol-4-Ol, 3-(2-(Methylamino)Ethyl)-, Dihydrogen Phosphate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N2O4P |
| Molecular Weight | 270.22 |
| CAS Registry Number | 21420-58-6 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2O[P](=O)(O)O)CCNC |
| InChI | 1S/C11H15N2O4P/c1-12-6-5-8-7-13-9-3-2-4-10(11(8)9)17-18(14,15)16/h2-4,7,12-13H,5-6H2,1H3,(H2,14,15,16) |
| InChIKey | WTPBXXCVZZZXKR-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.249°C at 760 mmHg (Cal.) |
| Flash point | 279.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-(Methylamino)ethyl]-1H-Indol-4-ol 4-(dihydrogen phosphate) |