|
CAS#: 21441-01-0 Product: 6,8-Dichloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One No suppilers available for the product. |
| Name | 6,8-Dichloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One |
|---|---|
| Synonyms | Brn 0651720; 4H-3,1-Benzoxazin-2-One, 1,2-Dihydro-6,8-Dichloro-4,4-Dimethyl-; 6,8-Dichloro-1,2-Dihydro-4,4-Dimethyl-4H-3,1-Benzoxazin-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 |
| CAS Registry Number | 21441-01-0 |
| SMILES | C1=C(Cl)C=C(Cl)C2=C1C(OC(=O)N2)(C)C |
| InChI | 1S/C10H9Cl2NO2/c1-10(2)6-3-5(11)4-7(12)8(6)13-9(14)15-10/h3-4H,1-2H3,(H,13,14) |
| InChIKey | MTQBQKRLIDTQKB-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.907°C at 760 mmHg (Cal.) |
| Flash point | 125.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dichloro-1,4-Dihydro-4,4-Dimethyl-2H-3,1-Benzoxazin-2-One |