|
CAS#: 21491-62-3 Product: Hydroxytremetone No suppilers available for the product. |
| Name | Hydroxytremetone |
|---|---|
| Synonyms | 1-[(2R)-6-Hydroxy-2-Isopropenyl-2,3-Dihydrobenzofuran-5-Yl]Ethanone; 6-Hydroxytremetone; C08744 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 21491-62-3 |
| SMILES | [C@@H]1(CC2=C(O1)C=C(C(=C2)C(=O)C)O)C(=C)C |
| InChI | 1S/C13H14O3/c1-7(2)12-5-9-4-10(8(3)14)11(15)6-13(9)16-12/h4,6,12,15H,1,5H2,2-3H3/t12-/m1/s1 |
| InChIKey | FHJSLVLVJPGFRY-GFCCVEGCSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.145°C at 760 mmHg (Cal.) |
| Flash point | 141.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxytremetone |