|
CAS#: 21530-69-8 Product: 3-Acetyl-2,3,4,4a,5,6-Hexahydro-1H-Pyrazino[1,2-a]Quinoline No suppilers available for the product. |
| Name | 3-Acetyl-2,3,4,4a,5,6-Hexahydro-1H-Pyrazino[1,2-a]Quinoline |
|---|---|
| Synonyms | 1H-Pyrazino(1,2-A)Quinoline, 2,3,4,4A,5,6-Hexahydro-3-Acetyl-; 1H-Pyrazino(1,2-A)Quinoline, 3-Acetyl-2,3,4,4A,5,6-Hexahydro-; 4-23-00-01199 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 |
| CAS Registry Number | 21530-69-8 |
| SMILES | C3=C2N1C(CN(C(=O)C)CC1)CCC2=CC=C3 |
| InChI | 1S/C14H18N2O/c1-11(17)15-8-9-16-13(10-15)7-6-12-4-2-3-5-14(12)16/h2-5,13H,6-10H2,1H3 |
| InChIKey | SAPAWHGNIMQFMR-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.838°C at 760 mmHg (Cal.) |
| Flash point | 197.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetyl-2,3,4,4a,5,6-Hexahydro-1H-Pyrazino[1,2-a]Quinoline |