|
CAS#: 21564-92-1 Product: 2,3-Dimethyltetralin No suppilers available for the product. |
| Name | 2,3-Dimethyltetralin |
|---|---|
| Synonyms | 2,3-Dimethyltetralin; Naphthalene, 1,2,3,4-Tetrahydro-2,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 21564-92-1 |
| SMILES | C1=CC2=C(C=C1)CC(C)C(C2)C |
| InChI | 1S/C12H16/c1-9-7-11-5-3-4-6-12(11)8-10(9)2/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | NJOXXZPRVMTBBP-UHFFFAOYSA-N |
| Density | 0.909g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.527°C at 760 mmHg (Cal.) |
| Flash point | 87.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyltetralin |