|
CAS#: 21618-99-5 Product: 4, alpha-Dimethyl-3-Tyramine No suppilers available for the product. |
| Name | 4, alpha-Dimethyl-3-Tyramine |
|---|---|
| Synonyms | 5-(2-Aminopropyl)-2-Methyl-Phenol Hydrochloride; 5-(2-Aminopropyl)-O-Phenol Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 |
| CAS Registry Number | 21618-99-5 (29440-90-2) |
| EINECS | 249-626-8 |
| SMILES | [H+].C1=CC(=CC(=C1C)O)CC(C)N.[Cl-] |
| InChI | 1S/C10H15NO.ClH/c1-7-3-4-9(5-8(2)11)6-10(7)12;/h3-4,6,8,12H,5,11H2,1-2H3;1H |
| InChIKey | GOXBCMKYABLWQZ-UHFFFAOYSA-N |
| Boiling point | 291.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 130.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4, alpha-Dimethyl-3-Tyramine |