|
CAS#: 21635-40-5 Product: 2-Methyl-3-(o-Tolyl)-4(3H)-Pteridinone No suppilers available for the product. |
| Name | 2-Methyl-3-(o-Tolyl)-4(3H)-Pteridinone |
|---|---|
| Synonyms | 2-Methyl-3-(2-Methylphenyl)-4-Pteridinone; 2-Methyl-3-(O-Tolyl)-4(3H)-Pteridinone; 4(3H)-Pteridinone, 2-Methyl-3-(O-Tolyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 |
| CAS Registry Number | 21635-40-5 |
| SMILES | C3=NC1=C(N=C(N(C1=O)C2=CC=CC=C2C)C)N=C3 |
| InChI | 1S/C14H12N4O/c1-9-5-3-4-6-11(9)18-10(2)17-13-12(14(18)19)15-7-8-16-13/h3-8H,1-2H3 |
| InChIKey | NCESXFWKDXOHFT-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.869°C at 760 mmHg (Cal.) |
| Flash point | 218.616°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(o-Tolyl)-4(3H)-Pteridinone |