|
CAS#: 21654-63-7 Product: 2,2,4-Trimethyl-3-phenyl-1,3,2-oxazasilolidin-5-one No suppilers available for the product. |
| Name | 2,2,4-Trimethyl-3-phenyl-1,3,2-oxazasilolidin-5-one |
|---|---|
| Synonyms | 2,2,4-Trimethyl-3-phenyl-1,3,2-oxazasilolidin-5-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2Si |
| Molecular Weight | 221.33 |
| CAS Registry Number | 21654-63-7 |
| SMILES | O=C2O[Si](N(c1ccccc1)C2C)(C)C |
| InChI | 1S/C11H15NO2Si/c1-9-11(13)14-15(2,3)12(9)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | ISEDPIGMBKBHQW-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.994°C at 760 mmHg (Cal.) |
| Flash point | 104.388°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethyl-3-phenyl-1,3,2-oxazasilolidin-5-one |