|
CAS#: 21879-83-4 Product: 4-Deoxyrhodosporin No suppilers available for the product. |
| Name | 4-Deoxyrhodosporin |
|---|---|
| Synonyms | (6R,7S)-6,7,9,10-Tetrahydroxy-2-Methoxy-7-Methyl-6,8-Dihydro-5H-Anthracene-1,4-Quinone; 4-Deoxybostrycin; 9,10-Anthracenedione, 1,2,3,4-Tetrahydro-2,3,5,8-Tetrahydroxy-7-Methoxy-2-Methyl-, (2S-Cis)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 |
| CAS Registry Number | 21879-83-4 |
| SMILES | [C@@]3(O)(CC1=C(C(=C2C(=C1O)C(=O)C(=CC2=O)OC)O)C[C@H]3O)C |
| InChI | 1S/C16H16O7/c1-16(22)5-7-6(3-10(16)18)13(19)11-8(17)4-9(23-2)15(21)12(11)14(7)20/h4,10,18-20,22H,3,5H2,1-2H3/t10-,16+/m1/s1 |
| InChIKey | NCLWGURXHFTQGF-HWPZZCPQSA-N |
| Density | 1.615g/cm3 (Cal.) |
|---|---|
| Boiling point | 655.049°C at 760 mmHg (Cal.) |
| Flash point | 247.211°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Deoxyrhodosporin |