|
CAS#: 21888-30-2 Product: beta-Phenylpropionyl-L-Phenylalanine No suppilers available for the product. |
| Name | beta-Phenylpropionyl-L-Phenylalanine |
|---|---|
| Synonyms | (2S)-2-[(1-Oxo-3-Phenylpropyl)Amino]-3-Phenylpropanoic Acid; (2S)-3-Phenyl-2-(3-Phenylpropanoylamino)Propionic Acid; L-Phenylalanine, N-(1-Oxo-3-Phenylpropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 |
| CAS Registry Number | 21888-30-2 |
| SMILES | [C@H](NC(=O)CCC1=CC=CC=C1)(CC2=CC=CC=C2)C(=O)O |
| InChI | 1S/C18H19NO3/c20-17(12-11-14-7-3-1-4-8-14)19-16(18(21)22)13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,19,20)(H,21,22)/t16-/m0/s1 |
| InChIKey | PKOVGZQJPDDEJO-INIZCTEOSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.371°C at 760 mmHg (Cal.) |
| Flash point | 289.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Phenylpropionyl-L-Phenylalanine |