| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | 2-[(2-Aminoacetyl)Amino]-3-(1H-Indol-3-Yl)Propanoic Acid |
| Synonyms | 2-[(2-Amino-1-Oxoethyl)Amino]-3-(1H-Indol-3-Yl)Propanoic Acid; 2-(Glycylamino)-3-(1H-Indol-3-Yl)Propionic Acid; 2-(2-Aminoethanoylamino)-3-(1H-Indol-3-Yl)Propanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 |
| CAS Registry Number | 2189-26-6 (2390-74-1) |
| EINECS | 218-581-6 |
| SMILES | C2=C(C1=C(C=CC=C1)[NH]2)CC(C(=O)O)NC(=O)CN |
| InChI | 1S/C13H15N3O3/c14-6-12(17)16-11(13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6,14H2,(H,16,17)(H,18,19) |
| InChIKey | AJHCSUXXECOXOY-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 621.843°C at 760 mmHg (Cal.) |
| Flash point | 329.879°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Aminoacetyl)Amino]-3-(1H-Indol-3-Yl)Propanoic Acid |