|
CAS#: 21940-29-4 Product: Mannosaminuronic Acid No suppilers available for the product. |
| Name | Mannosaminuronic Acid |
|---|---|
| Synonyms | (2S,3S,4R,5S)-5-Amino-2,3,4-Trihydroxy-6-Oxo-Hexanoic Acid; (2S,3S,4R,5S)-5-Amino-2,3,4-Trihydroxy-6-Keto-Hexanoic Acid; D-Mannuronic Acid, 2-Amino-2-Deoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 21940-29-4 |
| SMILES | [C@@H](O)([C@H](O)C(=O)O)[C@H](O)[C@H](N)C=O |
| InChI | 1S/C6H11NO6/c7-2(1-8)3(9)4(10)5(11)6(12)13/h1-5,9-11H,7H2,(H,12,13)/t2-,3-,4+,5+/m1/s1 |
| InChIKey | BBWFIUXRDWUZMZ-MBMOQRBOSA-N |
| Density | 1.648g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.015°C at 760 mmHg (Cal.) |
| Flash point | 323.935°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mannosaminuronic Acid |