|
CAS#: 21988-53-4 Product: Methylphosphonothioic Acid S-[2-[Bis(Isopropoxy)Phosphinylamino]Ethyl] O-Methyl Ester No suppilers available for the product. |
| Name | Methylphosphonothioic Acid S-[2-[Bis(Isopropoxy)Phosphinylamino]Ethyl] O-Methyl Ester |
|---|---|
| Synonyms | N-Diisopropoxyphosphoryl-2-(Methoxy-Methyl-Phosphoryl)Sulfanyl-Ethanamine; N-Diisopropoxyphosphoryl-2-[(Methoxy-Methylphosphoryl)Thio]Ethanamine; Diisopropoxyphosphoryl-[2-[(Methoxy-Methyl-Phosphoryl)Thio]Ethyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25NO5P2S |
| Molecular Weight | 333.32 |
| CAS Registry Number | 21988-53-4 |
| SMILES | C(S[P](=O)(OC)C)CN[P](=O)(OC(C)C)OC(C)C |
| InChI | 1S/C10H25NO5P2S/c1-9(2)15-18(13,16-10(3)4)11-7-8-19-17(6,12)14-5/h9-10H,7-8H2,1-6H3,(H,11,13) |
| InChIKey | OLLOFYSRHJNSFO-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.261°C at 760 mmHg (Cal.) |
| Flash point | 186.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylphosphonothioic Acid S-[2-[Bis(Isopropoxy)Phosphinylamino]Ethyl] O-Methyl Ester |