| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | (3R,7aS)-7A-Methyl-3-(Trichloromethyl)-3,5,6,7-Tetrahydropyrrolo[1,2-c]Oxazol-1-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl3NO2 |
| Molecular Weight | 258.53 |
| CAS Registry Number | 220200-88-4 |
| SMILES | C[C@@]12CCCN1[C@H](OC2=O)C(Cl)(Cl)Cl |
| InChI | 1S/C8H10Cl3NO2/c1-7-3-2-4-12(7)5(8(9,10)11)14-6(7)13/h5H,2-4H2,1H3/t5-,7+/m1/s1 |
| InChIKey | CQNBNGSUEQTECE-VDTYLAMSSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.464°C at 760 mmHg (Cal.) |
| Flash point | 154.869°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R,7aS)-7A-Methyl-3-(Trichloromethyl)-3,5,6,7-Tetrahydropyrrolo[1,2-c]Oxazol-1-One |