|
CAS#: 22057-31-4 Product: 1-[(2,4-Dinitrophenyl)Thio]-2-Propanone No suppilers available for the product. |
| Name | 1-[(2,4-Dinitrophenyl)Thio]-2-Propanone |
|---|---|
| Synonyms | 1-[(2,4-Dinitrophenyl)Thio]Propan-2-One; 1-[(2,4-Dinitrophenyl)Thio]Acetone; (2,4-Dinitrophenylthio)-2-Propanone |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2O5S |
| Molecular Weight | 256.23 |
| CAS Registry Number | 22057-31-4 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1[N+]([O-])=O)SCC(=O)C |
| InChI | 1S/C9H8N2O5S/c1-6(12)5-17-9-3-2-7(10(13)14)4-8(9)11(15)16/h2-4H,5H2,1H3 |
| InChIKey | AIGQWZZOCYGAHR-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.389°C at 760 mmHg (Cal.) |
| Flash point | 192.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2,4-Dinitrophenyl)Thio]-2-Propanone |