|
CAS#: 22123-87-1 Product: 5,7-Diphenyl-2,3,6,7-Tetrahydro-1H-1,4-Diazepine No suppilers available for the product. |
| Name | 5,7-Diphenyl-2,3,6,7-Tetrahydro-1H-1,4-Diazepine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 22123-87-1 |
| SMILES | N\3=C(/c1ccccc1)CC(c2ccccc2)NCC/3 |
| InChI | 1S/C17H18N2/c1-3-7-14(8-4-1)16-13-17(19-12-11-18-16)15-9-5-2-6-10-15/h1-10,16,18H,11-13H2 |
| InChIKey | NBADQICXGNWQMI-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.291°C at 760 mmHg (Cal.) |
| Flash point | 189.842°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Diphenyl-2,3,6,7-Tetrahydro-1H-1,4-Diazepine |