|
CAS#: 2213-84-5 Product: N-[Methoxy-(2,4,5-Trichlorophenoxy)Phosphoryl]Ethanamine No suppilers available for the product. |
| Name | N-[Methoxy-(2,4,5-Trichlorophenoxy)Phosphoryl]Ethanamine |
|---|---|
| Synonyms | Ethyl-[Methoxy-(2,4,5-Trichlorophenoxy)Phosphoryl]Amine; Brn 1888380; Dowco 159 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11Cl3NO3P |
| Molecular Weight | 318.52 |
| CAS Registry Number | 2213-84-5 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)O[P](=O)(OC)NCC)Cl |
| InChI | 1S/C9H11Cl3NO3P/c1-3-13-17(14,15-2)16-9-5-7(11)6(10)4-8(9)12/h4-5H,3H2,1-2H3,(H,13,14) |
| InChIKey | GFUPZVAJBBMJEJ-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.344°C at 760 mmHg (Cal.) |
| Flash point | 175.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[Methoxy-(2,4,5-Trichlorophenoxy)Phosphoryl]Ethanamine |