|
CAS#: 22167-98-2 Product: 2,4-Thiophenedi(Sulfonamide) No suppilers available for the product. |
| Name | 2,4-Thiophenedi(Sulfonamide) |
|---|---|
| Synonyms | 4-18-00-06726 (Beilstein Handbook Reference); Brn 0217573; Disulfamido-2,4 Thiophene [French] |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6N2O4S3 |
| Molecular Weight | 242.28 |
| CAS Registry Number | 22167-98-2 |
| SMILES | C1=C([S](N)(=O)=O)SC=C1[S](N)(=O)=O |
| InChI | 1S/C4H6N2O4S3/c5-12(7,8)3-1-4(11-2-3)13(6,9)10/h1-2H,(H2,5,7,8)(H2,6,9,10) |
| InChIKey | MCNVGCWBRVMJKE-UHFFFAOYSA-N |
| Density | 1.771g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.552°C at 760 mmHg (Cal.) |
| Flash point | 296.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Thiophenedi(Sulfonamide) |