|
CAS#: 22196-75-4 Product: (+-)-Ethambutol Dihydrochloride No suppilers available for the product. |
| Name | (+-)-Ethambutol Dihydrochloride |
|---|---|
| Synonyms | 4-Hydroxybutyl-[2-(4-Hydroxybutylammonio)Ethyl]Ammonium Dichloride; (+-)-Ethambutol Dihydrochloride; 1-Butanol, 2,2'-(Ethylenediimino)Di-, Dihydrochloride, (+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H26Cl2N2O2 |
| Molecular Weight | 277.23 |
| CAS Registry Number | 22196-75-4 |
| SMILES | C([NH2+]CCCCO)C[NH2+]CCCCO.[Cl-].[Cl-] |
| InChI | 1S/C10H24N2O2.2ClH/c13-9-3-1-5-11-7-8-12-6-2-4-10-14;;/h11-14H,1-10H2;2*1H |
| InChIKey | COGRWEZMVVEGEK-UHFFFAOYSA-N |
| Boiling point | 355.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+-)-Ethambutol Dihydrochloride |